C9H10N4OS — CID 822308
1,6,7-trimethyl-2-sulfanylidenepteridin-4-one (PubChem CID 822308) has the molecular formula C9H10N4OS and a molecular weight of 222.27 g/mol. Its IUPAC name is 1,6,7-trimethyl-2-sulfanylidenepteridin-4-one.
| Compound Name | 1,6,7-trimethyl-2-sulfanylidenepteridin-4-one |
|---|---|
| PubChem CID | 822308 |
| Molecular Formula | C9H10N4OS |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 1,6,7-trimethyl-2-sulfanylidenepteridin-4-one |
| SMILES | Cc1nc2c(=O)[nH]c(=S)n(C)c2nc1C |
| InChI | InChI=1S/C9H10N4OS/c1-4-5(2)11-7-6(10-4)8(14)12-9(15)13(7)3/h1-3H3,(H,12,14,15) |
| InChIKey | RWNSYATVVIYQDJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|