C9H10N4OS — CID 135408968
6,7-dimethyl-2-methylsulfanyl-3H-pteridin-4-one (PubChem CID 135408968) has the molecular formula C9H10N4OS and a molecular weight of 222.27 g/mol. Its IUPAC name is 6,7-dimethyl-2-methylsulfanyl-3H-pteridin-4-one.
| Compound Name | 6,7-dimethyl-2-methylsulfanyl-3H-pteridin-4-one |
|---|---|
| PubChem CID | 135408968 |
| Molecular Formula | C9H10N4OS |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 6,7-dimethyl-2-methylsulfanyl-3H-pteridin-4-one |
| SMILES | CSc1nc2nc(C)c(C)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C9H10N4OS/c1-4-5(2)11-7-6(10-4)8(14)13-9(12-7)15-3/h1-3H3,(H,11,12,13,14) |
| InChIKey | SGBPOWRTGPTLQG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |