C15H12N6O — CID 135769184
2-amino-7-(1H-indol-3-yl)-6-methyl-3H-pteridin-4-one (PubChem CID 135769184) has the molecular formula C15H12N6O and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-amino-7-(1H-indol-3-yl)-6-methyl-3H-pteridin-4-one.
| Compound Name | 2-amino-7-(1H-indol-3-yl)-6-methyl-3H-pteridin-4-one |
|---|---|
| PubChem CID | 135769184 |
| Molecular Formula | C15H12N6O |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-amino-7-(1H-indol-3-yl)-6-methyl-3H-pteridin-4-one |
| SMILES | Cc1nc2c(=O)[nH]c(N)nc2nc1-c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H12N6O/c1-7-11(9-6-17-10-5-3-2-4-8(9)10)19-13-12(18-7)14(22)21-15(16)20-13/h2-6,17H,1H3,(H3,16,19,20,21,22) |
| InChIKey | CCEVQJVQHZZLTL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |