C11H10N6 — CID 14358165
6-(1H-indol-3-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 14358165) has the molecular formula C11H10N6 and a molecular weight of 226.24 g/mol. Its IUPAC name is 6-(1H-indol-3-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1H-indol-3-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 14358165 |
| Molecular Formula | C11H10N6 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 6-(1H-indol-3-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C11H10N6/c12-10-15-9(16-11(13)17-10)7-5-14-8-4-2-1-3-6(7)8/h1-5,14H,(H4,12,13,15,16,17) |
| InChIKey | MOFOAOSWNGXWAS-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |