C14H10N4 — CID 175946267
2-(1H-indol-3-yl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 175946267) has the molecular formula C14H10N4 and a molecular weight of 234.26 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-(1H-indol-3-yl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 175946267 |
| Molecular Formula | C14H10N4 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-(1H-indol-3-yl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | c1ccc2c(-c3nc4ccccn4n3)c[nH]c2c1 |
| InChI | InChI=1S/C14H10N4/c1-2-6-12-10(5-1)11(9-15-12)14-16-13-7-3-4-8-18(13)17-14/h1-9,15H |
| InChIKey | GNOVBWRTCFRRKX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |