C11H8N2S2 — CID 116889652
2-(1H-indol-3-yl)-1,3-thiazole-4-thiol (PubChem CID 116889652) has the molecular formula C11H8N2S2 and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-1,3-thiazole-4-thiol.
| Compound Name | 2-(1H-indol-3-yl)-1,3-thiazole-4-thiol |
|---|---|
| PubChem CID | 116889652 |
| Molecular Formula | C11H8N2S2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 2-(1H-indol-3-yl)-1,3-thiazole-4-thiol |
| SMILES | Sc1csc(-c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C11H8N2S2/c14-10-6-15-11(13-10)8-5-12-9-4-2-1-3-7(8)9/h1-6,12,14H |
| InChIKey | BGWZRNKEPWKPOF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|