C10H12N4O — CID 137292829
2-amino-7-propan-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 137292829) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-amino-7-propan-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-7-propan-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137292829 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-amino-7-propan-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | CC(C)c1ccc2c(=O)[nH]c(N)nc2n1 |
| InChI | InChI=1S/C10H12N4O/c1-5(2)7-4-3-6-8(12-7)13-10(11)14-9(6)15/h3-5H,1-2H3,(H3,11,12,13,14,15) |
| InChIKey | XSKVXKAAPMUWFL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |