C6H5IN4O — CID 163206466
2-amino-6-iodo-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 163206466) has the molecular formula C6H5IN4O and a molecular weight of 276.04 g/mol. Its IUPAC name is 2-amino-6-iodo-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-6-iodo-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 163206466 |
| Molecular Formula | C6H5IN4O |
| Molecular Weight | 276.04 g/mol |
| Exact Mass | 275.95 |
| IUPAC Name | 2-amino-6-iodo-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | Nc1nc2[nH]c(I)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C6H5IN4O/c7-3-1-2-4(9-3)10-6(8)11-5(2)12/h1H,(H4,8,9,10,11,12) |
| InChIKey | XJFXMHVTBHOFFE-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.04 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|