C5H5N5O — CID 136912024
2-amino-8-deuterio-1,9-dihydropurin-6-one (PubChem CID 136912024) has the molecular formula C5H5N5O and a molecular weight of 152.14 g/mol. Its IUPAC name is 2-amino-8-deuterio-1,9-dihydropurin-6-one.
| Compound Name | 2-amino-8-deuterio-1,9-dihydropurin-6-one |
|---|---|
| PubChem CID | 136912024 |
| Molecular Formula | C5H5N5O |
| Molecular Weight | 152.14 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 2-amino-8-deuterio-1,9-dihydropurin-6-one |
| SMILES | [2H]c1nc2c(=O)[nH]c(N)nc2[nH]1 |
| InChI | InChI=1S/C5H5N5O/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11)/i1D |
| InChIKey | UYTPUPDQBNUYGX-MICDWDOJSA-N |
| XLogP | -0.77 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.14 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |