C8H7N3O3 — CID 137175521
2-amino-5,8-dihydroxy-3H-quinazolin-4-one (PubChem CID 137175521) has the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. Its IUPAC name is 2-amino-5,8-dihydroxy-3H-quinazolin-4-one.
| Compound Name | 2-amino-5,8-dihydroxy-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137175521 |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 2-amino-5,8-dihydroxy-3H-quinazolin-4-one |
| SMILES | Nc1nc2c(O)ccc(O)c2c(=O)[nH]1 |
| InChI | InChI=1S/C8H7N3O3/c9-8-10-6-4(13)2-1-3(12)5(6)7(14)11-8/h1-2,12-13H,(H3,9,10,11,14) |
| InChIKey | YIWGKSUWPVDPDQ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|