C7H5ClN4O — CID 135741629
2-amino-6-chloro-3H-pyrido[3,2-d]pyrimidin-4-one (PubChem CID 135741629) has the molecular formula C7H5ClN4O and a molecular weight of 196.60 g/mol. Its IUPAC name is 2-amino-6-chloro-3H-pyrido[3,2-d]pyrimidin-4-one.
| Compound Name | 2-amino-6-chloro-3H-pyrido[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135741629 |
| Molecular Formula | C7H5ClN4O |
| Molecular Weight | 196.60 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 2-amino-6-chloro-3H-pyrido[3,2-d]pyrimidin-4-one |
| SMILES | Nc1nc2ccc(Cl)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C7H5ClN4O/c8-4-2-1-3-5(11-4)6(13)12-7(9)10-3/h1-2H,(H3,9,10,12,13) |
| InChIKey | QDLDKZFCEXVVSU-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.60 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|