C7H7N5O2 — CID 162687807
2-amino-5-[(E)-hydroxyiminomethyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 162687807) has the molecular formula C7H7N5O2 and a molecular weight of 193.17 g/mol. Its IUPAC name is 2-amino-5-[(E)-hydroxyiminomethyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-5-[(E)-hydroxyiminomethyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 162687807 |
| Molecular Formula | C7H7N5O2 |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 2-amino-5-[(E)-hydroxyiminomethyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | Nc1nc2[nH]cc(/C=N/O)c2c(=O)[nH]1 |
| InChI | InChI=1S/C7H7N5O2/c8-7-11-5-4(6(13)12-7)3(1-9-5)2-10-14/h1-2,14H,(H4,8,9,11,12,13)/b10-2+ |
| InChIKey | MZWCJTKWCDBZLI-WTDSWWLTSA-N |
| XLogP | -0.36 |
| TPSA | 120.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|