C12H17N5O3 — CID 153340006
2-amino-5-(aminomethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one;cyclopent-3-ene-1,2-diol (PubChem CID 153340006) has the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-amino-5-(aminomethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one;cyclopent-3-ene-1,2-diol.
| Compound Name | 2-amino-5-(aminomethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one;cyclopent-3-ene-1,2-diol |
|---|---|
| PubChem CID | 153340006 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-amino-5-(aminomethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one;cyclopent-3-ene-1,2-diol |
| SMILES | NCc1c[nH]c2nc(N)[nH]c(=O)c12.OC1C=CCC1O |
| InChI | InChI=1S/C7H9N5O.C5H8O2/c8-1-3-2-10-5-4(3)6(13)12-7(9)11-5;6-4-2-1-3-5(4)7/h2H,1,8H2,(H4,9,10,11,12,13);1-2,4-7H,3H2 |
| InChIKey | FEUBDVMFMJWDNB-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 154.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|