C7H8IN5O — CID 137316542
2-amino-5-[(iodoamino)methyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 137316542) has the molecular formula C7H8IN5O and a molecular weight of 305.08 g/mol. Its IUPAC name is 2-amino-5-[(iodoamino)methyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-5-[(iodoamino)methyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137316542 |
| Molecular Formula | C7H8IN5O |
| Molecular Weight | 305.08 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | 2-amino-5-[(iodoamino)methyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | Nc1nc2[nH]cc(CNI)c2c(=O)[nH]1 |
| InChI | InChI=1S/C7H8IN5O/c8-11-2-3-1-10-5-4(3)6(14)13-7(9)12-5/h1,11H,2H2,(H4,9,10,12,13,14) |
| InChIKey | LGCGGRPNXNYUSQ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.08 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|