C11H15N5O5S — CID 138530219
4-[(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methylamino]-4-oxobutane-1-sulfonic acid (PubChem CID 138530219) has the molecular formula C11H15N5O5S and a molecular weight of 329.34 g/mol. Its IUPAC name is 4-[(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methylamino]-4-oxobutane-1-sulfonic acid.
| Compound Name | 4-[(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methylamino]-4-oxobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 138530219 |
| Molecular Formula | C11H15N5O5S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 4-[(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methylamino]-4-oxobutane-1-sulfonic acid |
| SMILES | Nc1nc2[nH]cc(CNC(=O)CCCS(=O)(=O)O)c2c(=O)[nH]1 |
| InChI | InChI=1S/C11H15N5O5S/c12-11-15-9-8(10(18)16-11)6(5-14-9)4-13-7(17)2-1-3-22(19,20)21/h5H,1-4H2,(H,13,17)(H,19,20,21)(H4,12,14,15,16,18) |
| InChIKey | NSLXNHMYBJYXQR-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 171.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|