C16H18N5O2+ — CID 169060181
(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methyl-(3-oxo-3-phenylpropyl)azanium (PubChem CID 169060181) has the molecular formula C16H18N5O2+ and a molecular weight of 312.35 g/mol. Its IUPAC name is (2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methyl-(3-oxo-3-phenylpropyl)azanium.
| Compound Name | (2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methyl-(3-oxo-3-phenylpropyl)azanium |
|---|---|
| PubChem CID | 169060181 |
| Molecular Formula | C16H18N5O2+ |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methyl-(3-oxo-3-phenylpropyl)azanium |
| SMILES | Nc1nc2[nH]cc(C[NH2+]CCC(=O)c3ccccc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C16H17N5O2/c17-16-20-14-13(15(23)21-16)11(9-19-14)8-18-7-6-12(22)10-4-2-1-3-5-10/h1-5,9,18H,6-8H2,(H4,17,19,20,21,23)/p+1 |
| InChIKey | ZMIPPQVYAAILLE-UHFFFAOYSA-O |
| XLogP | 0.17 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|