C14H13N5O — CID 135617077
2-amino-5-(benzyliminomethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 135617077) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-amino-5-(benzyliminomethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-5-(benzyliminomethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135617077 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-amino-5-(benzyliminomethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | Nc1nc2[nH]cc(/C=N/Cc3ccccc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C14H13N5O/c15-14-18-12-11(13(20)19-14)10(8-17-12)7-16-6-9-4-2-1-3-5-9/h1-5,7-8H,6H2,(H4,15,17,18,19,20)/b16-7+ |
| InChIKey | QKJFWDHYVBUASQ-FRKPEAEDSA-N |
| XLogP | 1.45 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|