C18H22N5O+ — CID 169060184
(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methyl-[2-(1-phenylcyclopropyl)ethyl]azanium (PubChem CID 169060184) has the molecular formula C18H22N5O+ and a molecular weight of 324.41 g/mol. Its IUPAC name is (2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methyl-[2-(1-phenylcyclopropyl)ethyl]azanium.
| Compound Name | (2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methyl-[2-(1-phenylcyclopropyl)ethyl]azanium |
|---|---|
| PubChem CID | 169060184 |
| Molecular Formula | C18H22N5O+ |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methyl-[2-(1-phenylcyclopropyl)ethyl]azanium |
| SMILES | Nc1nc2[nH]cc(C[NH2+]CCC3(c4ccccc4)CC3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C18H21N5O/c19-17-22-15-14(16(24)23-17)12(11-21-15)10-20-9-8-18(6-7-18)13-4-2-1-3-5-13/h1-5,11,20H,6-10H2,(H4,19,21,22,23,24)/p+1 |
| InChIKey | OLJVLNLZHSSLEJ-UHFFFAOYSA-O |
| XLogP | 1.02 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|