C15H21N5O3 — CID 142296977
2-amino-5-(aminomethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one;2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole (PubChem CID 142296977) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is 2-amino-5-(aminomethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one;2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole.
| Compound Name | 2-amino-5-(aminomethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one;2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole |
|---|---|
| PubChem CID | 142296977 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 2-amino-5-(aminomethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one;2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole |
| SMILES | CC1(C)OC2C=CCC2O1.NCc1c[nH]c2nc(N)[nH]c(=O)c12 |
| InChI | InChI=1S/C8H12O2.C7H9N5O/c1-8(2)9-6-4-3-5-7(6)10-8;8-1-3-2-10-5-4(3)6(13)12-7(9)11-5/h3-4,6-7H,5H2,1-2H3;2H,1,8H2,(H4,9,10,11,12,13) |
| InChIKey | DCHNWBUMRWKFFE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 132.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|