C16H15N4O2Y- — CID 167680396
5-[2-(4-acetylphenyl)ethyl]-2-amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one;yttrium (PubChem CID 167680396) has the molecular formula C16H15N4O2Y- and a molecular weight of 384.23 g/mol. Its IUPAC name is 5-[2-(4-acetylphenyl)ethyl]-2-amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one;yttrium.
| Compound Name | 5-[2-(4-acetylphenyl)ethyl]-2-amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one;yttrium |
|---|---|
| PubChem CID | 167680396 |
| Molecular Formula | C16H15N4O2Y- |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 5-[2-(4-acetylphenyl)ethyl]-2-amino-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one;yttrium |
| SMILES | [CH2-]C(=O)c1ccc(CCc2c[nH]c3nc(N)[nH]c(=O)c23)cc1.[Y] |
| InChI | InChI=1S/C16H15N4O2.Y/c1-9(21)11-5-2-10(3-6-11)4-7-12-8-18-14-13(12)15(22)20-16(17)19-14;/h2-3,5-6,8H,1,4,7H2,(H4,17,18,19,20,22);/q-1; |
| InChIKey | UCFHXFRQKDASJZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|