C15H18N5OS+ — CID 163832052
(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methyl-(2-phenylsulfanylethyl)azanium (PubChem CID 163832052) has the molecular formula C15H18N5OS+ and a molecular weight of 316.41 g/mol. Its IUPAC name is (2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methyl-(2-phenylsulfanylethyl)azanium.
| Compound Name | (2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methyl-(2-phenylsulfanylethyl)azanium |
|---|---|
| PubChem CID | 163832052 |
| Molecular Formula | C15H18N5OS+ |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)methyl-(2-phenylsulfanylethyl)azanium |
| SMILES | Nc1nc2[nH]cc(C[NH2+]CCSc3ccccc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C15H17N5OS/c16-15-19-13-12(14(21)20-15)10(9-18-13)8-17-6-7-22-11-4-2-1-3-5-11/h1-5,9,17H,6-8H2,(H4,16,18,19,20,21)/p+1 |
| InChIKey | OELDMUHOAXHODE-UHFFFAOYSA-O |
| XLogP | 0.69 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|