C9H11ClN4O — CID 144514753
(NZ)-N-[(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)methylidene]hydroxylamine;ethane (PubChem CID 144514753) has the molecular formula C9H11ClN4O and a molecular weight of 226.67 g/mol. Its IUPAC name is (NZ)-N-[(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)methylidene]hydroxylamine;ethane.
| Compound Name | (NZ)-N-[(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)methylidene]hydroxylamine;ethane |
|---|---|
| PubChem CID | 144514753 |
| Molecular Formula | C9H11ClN4O |
| Molecular Weight | 226.67 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | (NZ)-N-[(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)methylidene]hydroxylamine;ethane |
| SMILES | CC.O/N=C\c1c[nH]c2ncnc(Cl)c12 |
| InChI | InChI=1S/C7H5ClN4O.C2H6/c8-6-5-4(2-12-13)1-9-7(5)11-3-10-6;1-2/h1-3,13H,(H,9,10,11);1-2H3/b12-2-; |
| InChIKey | GXUAJVCSHAXBSO-QPBZENRTSA-N |
| XLogP | 2.45 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.67 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|