2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid

C7H5N5O4 — CID 135408140

IUPAC2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid
SMILESNc1nc2[nH]c(=O)c(C(=O)O)nc2c(=O)[nH]1
InChIInChI=1S/C7H5N5O4/c8-7-11-3-1(4(13)12-7)9-2(6(15)16)5(14)10-3/h(H,15,16)(H4,8,10,11,12,13,14)
InChIKeyWFICTSPBINOLJT-UHFFFAOYSA-N
MW223.15 g/mol
LogP-1.71
Rot. Bonds1

About 2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid

2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid (PubChem CID 135408140) has the molecular formula C7H5N5O4 and a molecular weight of 223.15 g/mol. Its IUPAC name is 2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid.

Molecular Properties

Compound Name2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid
PubChem CID135408140
Molecular FormulaC7H5N5O4
Molecular Weight223.15 g/mol
Exact Mass223.03
IUPAC Name2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid
SMILESNc1nc2[nH]c(=O)c(C(=O)O)nc2c(=O)[nH]1
InChIInChI=1S/C7H5N5O4/c8-7-11-3-1(4(13)12-7)9-2(6(15)16)5(14)10-3/h(H,15,16)(H4,8,10,11,12,13,14)
InChIKeyWFICTSPBINOLJT-UHFFFAOYSA-N
XLogP-1.71
TPSA154.82 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.15
LogP ≤ 5-1.71
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Analyze 2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid?
The IUPAC name of 2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid (CID 135408140) is 2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid.
What is the SMILES notation for 2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid?
The canonical SMILES for 2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid is Nc1nc2[nH]c(=O)c(C(=O)O)nc2c(=O)[nH]1.
What is the InChIKey of 2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid?
The InChIKey is WFICTSPBINOLJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N5O4/c8-7-11-3-1(4(13)12-7)9-2(6(15)16)5(14)10-3/h(H,15,16)(H4,8,10,11,12,13,14).
What are the key properties of 2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid?
2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid has a molecular weight of 223.15 g/mol, XLogP of -1.71, 1 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid is sourced from PubChem (CID 135408140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).