C7H5N5O4 — CID 135408140
2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid (PubChem CID 135408140) has the molecular formula C7H5N5O4 and a molecular weight of 223.15 g/mol. Its IUPAC name is 2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid.
| Compound Name | 2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid |
|---|---|
| PubChem CID | 135408140 |
| Molecular Formula | C7H5N5O4 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid |
| SMILES | Nc1nc2[nH]c(=O)c(C(=O)O)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C7H5N5O4/c8-7-11-3-1(4(13)12-7)9-2(6(15)16)5(14)10-3/h(H,15,16)(H4,8,10,11,12,13,14) |
| InChIKey | WFICTSPBINOLJT-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 154.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |