C9H9N5O4 — CID 135436104
2-amino-8-ethyl-4,7-dioxo-3H-pteridine-6-carboxylic acid (PubChem CID 135436104) has the molecular formula C9H9N5O4 and a molecular weight of 251.20 g/mol. Its IUPAC name is 2-amino-8-ethyl-4,7-dioxo-3H-pteridine-6-carboxylic acid.
| Compound Name | 2-amino-8-ethyl-4,7-dioxo-3H-pteridine-6-carboxylic acid |
|---|---|
| PubChem CID | 135436104 |
| Molecular Formula | C9H9N5O4 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-amino-8-ethyl-4,7-dioxo-3H-pteridine-6-carboxylic acid |
| SMILES | CCn1c(=O)c(C(=O)O)nc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C9H9N5O4/c1-2-14-5-3(6(15)13-9(10)12-5)11-4(7(14)16)8(17)18/h2H2,1H3,(H,17,18)(H3,10,12,13,15) |
| InChIKey | HHRIRRFAMDQGTJ-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 143.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |