C9H11N5O3 — CID 137158185
3-(2-amino-8-methyl-6-oxo-1H-purin-9-yl)propanoic acid (PubChem CID 137158185) has the molecular formula C9H11N5O3 and a molecular weight of 237.22 g/mol. Its IUPAC name is 3-(2-amino-8-methyl-6-oxo-1H-purin-9-yl)propanoic acid.
| Compound Name | 3-(2-amino-8-methyl-6-oxo-1H-purin-9-yl)propanoic acid |
|---|---|
| PubChem CID | 137158185 |
| Molecular Formula | C9H11N5O3 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 3-(2-amino-8-methyl-6-oxo-1H-purin-9-yl)propanoic acid |
| SMILES | Cc1nc2c(=O)[nH]c(N)nc2n1CCC(=O)O |
| InChI | InChI=1S/C9H11N5O3/c1-4-11-6-7(12-9(10)13-8(6)17)14(4)3-2-5(15)16/h2-3H2,1H3,(H,15,16)(H3,10,12,13,17) |
| InChIKey | ZGGRHXXLVDSPCG-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |