C11H16BrN5O2 — CID 135415602
2-amino-8-bromo-9-(6-hydroxyhexyl)-1H-purin-6-one (PubChem CID 135415602) has the molecular formula C11H16BrN5O2 and a molecular weight of 330.19 g/mol. Its IUPAC name is 2-amino-8-bromo-9-(6-hydroxyhexyl)-1H-purin-6-one.
| Compound Name | 2-amino-8-bromo-9-(6-hydroxyhexyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 135415602 |
| Molecular Formula | C11H16BrN5O2 |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 2-amino-8-bromo-9-(6-hydroxyhexyl)-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(Br)n2CCCCCCO)c(=O)[nH]1 |
| InChI | InChI=1S/C11H16BrN5O2/c12-10-14-7-8(15-11(13)16-9(7)19)17(10)5-3-1-2-4-6-18/h18H,1-6H2,(H3,13,15,16,19) |
| InChIKey | WOJDIKAQXPTWFU-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|