C11H13N5O4 — CID 135988429
2-[2-amino-8-(2-methylpropanoyl)-6-oxo-1H-purin-9-yl]acetic acid (PubChem CID 135988429) has the molecular formula C11H13N5O4 and a molecular weight of 279.26 g/mol. Its IUPAC name is 2-[2-amino-8-(2-methylpropanoyl)-6-oxo-1H-purin-9-yl]acetic acid.
| Compound Name | 2-[2-amino-8-(2-methylpropanoyl)-6-oxo-1H-purin-9-yl]acetic acid |
|---|---|
| PubChem CID | 135988429 |
| Molecular Formula | C11H13N5O4 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-[2-amino-8-(2-methylpropanoyl)-6-oxo-1H-purin-9-yl]acetic acid |
| SMILES | CC(C)C(=O)c1nc2c(=O)[nH]c(N)nc2n1CC(=O)O |
| InChI | InChI=1S/C11H13N5O4/c1-4(2)7(19)9-13-6-8(16(9)3-5(17)18)14-11(12)15-10(6)20/h4H,3H2,1-2H3,(H,17,18)(H3,12,14,15,20) |
| InChIKey | LUJRJKXWFBACPX-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 143.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |