C9H10F3N5O — CID 135999907
2-amino-9-propan-2-yl-8-(trifluoromethyl)-1H-purin-6-one (PubChem CID 135999907) has the molecular formula C9H10F3N5O and a molecular weight of 261.21 g/mol. Its IUPAC name is 2-amino-9-propan-2-yl-8-(trifluoromethyl)-1H-purin-6-one.
| Compound Name | 2-amino-9-propan-2-yl-8-(trifluoromethyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 135999907 |
| Molecular Formula | C9H10F3N5O |
| Molecular Weight | 261.21 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-amino-9-propan-2-yl-8-(trifluoromethyl)-1H-purin-6-one |
| SMILES | CC(C)n1c(C(F)(F)F)nc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C9H10F3N5O/c1-3(2)17-5-4(6(18)16-8(13)15-5)14-7(17)9(10,11)12/h3H,1-2H3,(H3,13,15,16,18) |
| InChIKey | NYCZFZFDICQHLD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |