C7H7N5O2 — CID 137003628
2-amino-9-methyl-6-oxo-1H-purine-8-carbaldehyde (PubChem CID 137003628) has the molecular formula C7H7N5O2 and a molecular weight of 193.17 g/mol. Its IUPAC name is 2-amino-9-methyl-6-oxo-1H-purine-8-carbaldehyde.
| Compound Name | 2-amino-9-methyl-6-oxo-1H-purine-8-carbaldehyde |
|---|---|
| PubChem CID | 137003628 |
| Molecular Formula | C7H7N5O2 |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 2-amino-9-methyl-6-oxo-1H-purine-8-carbaldehyde |
| SMILES | Cn1c(C=O)nc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C7H7N5O2/c1-12-3(2-13)9-4-5(12)10-7(8)11-6(4)14/h2H,1H3,(H3,8,10,11,14) |
| InChIKey | PVWJBRCTLTZQPO-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|