C13H17N5O3 — CID 136851603
2-amino-6-[(1S,2S)-2-hydroxycyclohexyl]-8-methyl-3H-pteridine-4,7-dione (PubChem CID 136851603) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-amino-6-[(1S,2S)-2-hydroxycyclohexyl]-8-methyl-3H-pteridine-4,7-dione.
| Compound Name | 2-amino-6-[(1S,2S)-2-hydroxycyclohexyl]-8-methyl-3H-pteridine-4,7-dione |
|---|---|
| PubChem CID | 136851603 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-amino-6-[(1S,2S)-2-hydroxycyclohexyl]-8-methyl-3H-pteridine-4,7-dione |
| SMILES | Cn1c(=O)c([C@@H]2CCCC[C@@H]2O)nc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C13H17N5O3/c1-18-10-9(11(20)17-13(14)16-10)15-8(12(18)21)6-4-2-3-5-7(6)19/h6-7,19H,2-5H2,1H3,(H3,14,16,17,20)/t6-,7+/m1/s1 |
| InChIKey | QFDNAJLVDWQHJE-RQJHMYQMSA-N |
| XLogP | -0.38 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |