C7H7N5O4 — CID 137234569
2-amino-8-hydroxy-6-(hydroxymethyl)-3H-pteridine-4,7-dione (PubChem CID 137234569) has the molecular formula C7H7N5O4 and a molecular weight of 225.16 g/mol. Its IUPAC name is 2-amino-8-hydroxy-6-(hydroxymethyl)-3H-pteridine-4,7-dione.
| Compound Name | 2-amino-8-hydroxy-6-(hydroxymethyl)-3H-pteridine-4,7-dione |
|---|---|
| PubChem CID | 137234569 |
| Molecular Formula | C7H7N5O4 |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 2-amino-8-hydroxy-6-(hydroxymethyl)-3H-pteridine-4,7-dione |
| SMILES | Nc1nc2c(nc(CO)c(=O)n2O)c(=O)[nH]1 |
| InChI | InChI=1S/C7H7N5O4/c8-7-10-4-3(5(14)11-7)9-2(1-13)6(15)12(4)16/h13,16H,1H2,(H3,8,10,11,14) |
| InChIKey | GXIBESKPCVFWGO-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 147.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|