C11H17N5O4 — CID 177418333
2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-8-(111C)methoxy-1H-purin-6-one (PubChem CID 177418333) has the molecular formula C11H17N5O4 and a molecular weight of 282.29 g/mol. Its IUPAC name is 2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-8-(111C)methoxy-1H-purin-6-one.
| Compound Name | 2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-8-(111C)methoxy-1H-purin-6-one |
|---|---|
| PubChem CID | 177418333 |
| Molecular Formula | C11H17N5O4 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-8-(111C)methoxy-1H-purin-6-one |
| SMILES | [11CH3]Oc1nc2c(=O)[nH]c(N)nc2n1CCC(CO)CO |
| InChI | InChI=1S/C11H17N5O4/c1-20-11-13-7-8(14-10(12)15-9(7)19)16(11)3-2-6(4-17)5-18/h6,17-18H,2-5H2,1H3,(H3,12,14,15,19)/i1-1 |
| InChIKey | PETYTRLALGMSLB-BJUDXGSMSA-N |
| XLogP | -1.30 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |