C10H15BrN5O6P — CID 155523276
2-[(2S)-1-(2-amino-8-bromo-6-oxo-1H-purin-9-yl)-3-hydroxypropan-2-yl]oxyethylphosphonic acid (PubChem CID 155523276) has the molecular formula C10H15BrN5O6P and a molecular weight of 412.14 g/mol. Its IUPAC name is 2-[(2S)-1-(2-amino-8-bromo-6-oxo-1H-purin-9-yl)-3-hydroxypropan-2-yl]oxyethylphosphonic acid.
| Compound Name | 2-[(2S)-1-(2-amino-8-bromo-6-oxo-1H-purin-9-yl)-3-hydroxypropan-2-yl]oxyethylphosphonic acid |
|---|---|
| PubChem CID | 155523276 |
| Molecular Formula | C10H15BrN5O6P |
| Molecular Weight | 412.14 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 2-[(2S)-1-(2-amino-8-bromo-6-oxo-1H-purin-9-yl)-3-hydroxypropan-2-yl]oxyethylphosphonic acid |
| SMILES | Nc1nc2c(nc(Br)n2C[C@@H](CO)OCCP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H15BrN5O6P/c11-9-13-6-7(14-10(12)15-8(6)18)16(9)3-5(4-17)22-1-2-23(19,20)21/h5,17H,1-4H2,(H2,19,20,21)(H3,12,14,15,18)/t5-/m0/s1 |
| InChIKey | SSHSIUPMQNBIBM-YFKPBYRVSA-N |
| XLogP | -0.98 |
| TPSA | 176.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.14 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|