C12H18N6O3S — CID 166788995
2-[[2-amino-9-(2-hydroxyethyl)-6-oxo-1H-purin-8-yl]sulfanyl]-N-propylacetamide (PubChem CID 166788995) has the molecular formula C12H18N6O3S and a molecular weight of 326.38 g/mol. Its IUPAC name is 2-[[2-amino-9-(2-hydroxyethyl)-6-oxo-1H-purin-8-yl]sulfanyl]-N-propylacetamide.
| Compound Name | 2-[[2-amino-9-(2-hydroxyethyl)-6-oxo-1H-purin-8-yl]sulfanyl]-N-propylacetamide |
|---|---|
| PubChem CID | 166788995 |
| Molecular Formula | C12H18N6O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-[[2-amino-9-(2-hydroxyethyl)-6-oxo-1H-purin-8-yl]sulfanyl]-N-propylacetamide |
| SMILES | CCCNC(=O)CSc1nc2c(=O)[nH]c(N)nc2n1CCO |
| InChI | InChI=1S/C12H18N6O3S/c1-2-3-14-7(20)6-22-12-15-8-9(18(12)4-5-19)16-11(13)17-10(8)21/h19H,2-6H2,1H3,(H,14,20)(H3,13,16,17,21) |
| InChIKey | DXPQHSKRDIWKBM-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 138.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |