C18H20N8O2S — CID 166788906
2-amino-8-[2-(1-benzyltriazol-4-yl)ethylsulfanyl]-9-(2-hydroxyethyl)-1H-purin-6-one (PubChem CID 166788906) has the molecular formula C18H20N8O2S and a molecular weight of 412.48 g/mol. Its IUPAC name is 2-amino-8-[2-(1-benzyltriazol-4-yl)ethylsulfanyl]-9-(2-hydroxyethyl)-1H-purin-6-one.
| Compound Name | 2-amino-8-[2-(1-benzyltriazol-4-yl)ethylsulfanyl]-9-(2-hydroxyethyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 166788906 |
| Molecular Formula | C18H20N8O2S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 2-amino-8-[2-(1-benzyltriazol-4-yl)ethylsulfanyl]-9-(2-hydroxyethyl)-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(SCCc3cn(Cc4ccccc4)nn3)n2CCO)c(=O)[nH]1 |
| InChI | InChI=1S/C18H20N8O2S/c19-17-21-15-14(16(28)22-17)20-18(26(15)7-8-27)29-9-6-13-11-25(24-23-13)10-12-4-2-1-3-5-12/h1-5,11,27H,6-10H2,(H3,19,21,22,28) |
| InChIKey | HURXSDIZYAERTL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |