About 2-amino-8-(1,3-benzothiazol-2-ylsulfanyl)-9-(2-hydroxyethyl)-1H-purin-6-one
2-amino-8-(1,3-benzothiazol-2-ylsulfanyl)-9-(2-hydroxyethyl)-1H-purin-6-one (PubChem CID 166788821) has the molecular formula C14H12N6O2S2
and a molecular weight of 360.42 g/mol. Its IUPAC name is 2-amino-8-(1,3-benzothiazol-2-ylsulfanyl)-9-(2-hydroxyethyl)-1H-purin-6-one.
Molecular Properties
| Compound Name | 2-amino-8-(1,3-benzothiazol-2-ylsulfanyl)-9-(2-hydroxyethyl)-1H-purin-6-one |
| PubChem CID | 166788821 |
| Molecular Formula | C14H12N6O2S2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 2-amino-8-(1,3-benzothiazol-2-ylsulfanyl)-9-(2-hydroxyethyl)-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(Sc3nc4ccccc4s3)n2CCO)c(=O)[nH]1 |
| InChI | InChI=1S/C14H12N6O2S2/c15-12-18-10-9(11(22)19-12)17-13(20(10)5-6-21)24-14-16-7-3-1-2-4-8(7)23-14/h1-4,21H,5-6H2,(H3,15,18,19,22) |
| InChIKey | PMTWALNJIOKHSA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-amino-8-(1,3-benzothiazol-2-ylsulfanyl)-9-(2-hydroxyethyl)-1H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-8-(1,3-benzothiazol-2-ylsulfanyl)-9-(2-hydroxyethyl)-1H-purin-6-one?
The IUPAC name of 2-amino-8-(1,3-benzothiazol-2-ylsulfanyl)-9-(2-hydroxyethyl)-1H-purin-6-one (CID 166788821) is 2-amino-8-(1,3-benzothiazol-2-ylsulfanyl)-9-(2-hydroxyethyl)-1H-purin-6-one.
What is the SMILES notation for 2-amino-8-(1,3-benzothiazol-2-ylsulfanyl)-9-(2-hydroxyethyl)-1H-purin-6-one?
The canonical SMILES for 2-amino-8-(1,3-benzothiazol-2-ylsulfanyl)-9-(2-hydroxyethyl)-1H-purin-6-one is Nc1nc2c(nc(Sc3nc4ccccc4s3)n2CCO)c(=O)[nH]1.
What is the InChIKey of 2-amino-8-(1,3-benzothiazol-2-ylsulfanyl)-9-(2-hydroxyethyl)-1H-purin-6-one?
The InChIKey is PMTWALNJIOKHSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N6O2S2/c15-12-18-10-9(11(22)19-12)17-13(20(10)5-6-21)24-14-16-7-3-1-2-4-8(7)23-14/h1-4,21H,5-6H2,(H3,15,18,19,22).
What are the key properties of 2-amino-8-(1,3-benzothiazol-2-ylsulfanyl)-9-(2-hydroxyethyl)-1H-purin-6-one?
2-amino-8-(1,3-benzothiazol-2-ylsulfanyl)-9-(2-hydroxyethyl)-1H-purin-6-one has a molecular weight of 360.42 g/mol, XLogP of 1.46, 4 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-8-(1,3-benzothiazol-2-ylsulfanyl)-9-(2-hydroxyethyl)-1H-purin-6-one is sourced from PubChem (CID 166788821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).