C12H9NOS3 — CID 107365183
[5-(1,3-benzothiazol-2-ylsulfanyl)thiophen-2-yl]methanol (PubChem CID 107365183) has the molecular formula C12H9NOS3 and a molecular weight of 279.41 g/mol. Its IUPAC name is [5-(1,3-benzothiazol-2-ylsulfanyl)thiophen-2-yl]methanol.
| Compound Name | [5-(1,3-benzothiazol-2-ylsulfanyl)thiophen-2-yl]methanol |
|---|---|
| PubChem CID | 107365183 |
| Molecular Formula | C12H9NOS3 |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 278.98 |
| IUPAC Name | [5-(1,3-benzothiazol-2-ylsulfanyl)thiophen-2-yl]methanol |
| SMILES | OCc1ccc(Sc2nc3ccccc3s2)s1 |
| InChI | InChI=1S/C12H9NOS3/c14-7-8-5-6-11(15-8)17-12-13-9-3-1-2-4-10(9)16-12/h1-6,14H,7H2 |
| InChIKey | ZWOSWMZVNTYHQH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |