C13H10N2OS2 — CID 80651110
[6-(1,3-benzothiazol-2-ylsulfanyl)-3-pyridinyl]methanol (PubChem CID 80651110) has the molecular formula C13H10N2OS2 and a molecular weight of 274.37 g/mol. Its IUPAC name is [6-(1,3-benzothiazol-2-ylsulfanyl)-3-pyridinyl]methanol.
| Compound Name | [6-(1,3-benzothiazol-2-ylsulfanyl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 80651110 |
| Molecular Formula | C13H10N2OS2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | [6-(1,3-benzothiazol-2-ylsulfanyl)-3-pyridinyl]methanol |
| SMILES | OCc1ccc(Sc2nc3ccccc3s2)nc1 |
| InChI | InChI=1S/C13H10N2OS2/c16-8-9-5-6-12(14-7-9)18-13-15-10-3-1-2-4-11(10)17-13/h1-7,16H,8H2 |
| InChIKey | OHDXZUZCEFMFMB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |