C17H17N3O2S3 — CID 32681682
2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]-1,3-benzothiazole (PubChem CID 32681682) has the molecular formula C17H17N3O2S3 and a molecular weight of 391.54 g/mol. Its IUPAC name is 2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]-1,3-benzothiazole.
| Compound Name | 2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 32681682 |
| Molecular Formula | C17H17N3O2S3 |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]-1,3-benzothiazole |
| SMILES | O=S(=O)(c1ccc(Sc2nc3ccccc3s2)nc1)N1CCCCC1 |
| InChI | InChI=1S/C17H17N3O2S3/c21-25(22,20-10-4-1-5-11-20)13-8-9-16(18-12-13)24-17-19-14-6-2-3-7-15(14)23-17/h2-3,6-9,12H,1,4-5,10-11H2 |
| InChIKey | BYZMPPWAGCFUPT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |