C22H20N2O2S2 — CID 7594099
2-(9H-fluoren-9-ylsulfanyl)-5-pyrrolidin-1-ylsulfonylpyridine (PubChem CID 7594099) has the molecular formula C22H20N2O2S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylsulfanyl)-5-pyrrolidin-1-ylsulfonylpyridine.
| Compound Name | 2-(9H-fluoren-9-ylsulfanyl)-5-pyrrolidin-1-ylsulfonylpyridine |
|---|---|
| PubChem CID | 7594099 |
| Molecular Formula | C22H20N2O2S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2-(9H-fluoren-9-ylsulfanyl)-5-pyrrolidin-1-ylsulfonylpyridine |
| SMILES | O=S(=O)(c1ccc(SC2c3ccccc3-c3ccccc32)nc1)N1CCCC1 |
| InChI | InChI=1S/C22H20N2O2S2/c25-28(26,24-13-5-6-14-24)16-11-12-21(23-15-16)27-22-19-9-3-1-7-17(19)18-8-2-4-10-20(18)22/h1-4,7-12,15,22H,5-6,13-14H2 |
| InChIKey | YBVVZDZDQIVVMT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |