C22H22N2O3S — CID 2538848
2-(2-phenylphenoxy)-5-piperidin-1-ylsulfonylpyridine (PubChem CID 2538848) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is 2-(2-phenylphenoxy)-5-piperidin-1-ylsulfonylpyridine.
| Compound Name | 2-(2-phenylphenoxy)-5-piperidin-1-ylsulfonylpyridine |
|---|---|
| PubChem CID | 2538848 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 2-(2-phenylphenoxy)-5-piperidin-1-ylsulfonylpyridine |
| SMILES | O=S(=O)(c1ccc(Oc2ccccc2-c2ccccc2)nc1)N1CCCCC1 |
| InChI | InChI=1S/C22H22N2O3S/c25-28(26,24-15-7-2-8-16-24)19-13-14-22(23-17-19)27-21-12-6-5-11-20(21)18-9-3-1-4-10-18/h1,3-6,9-14,17H,2,7-8,15-16H2 |
| InChIKey | WGYQSCUNHSESTP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |