C11H16N2O3S — CID 5268012
2-methoxy-5-piperidin-1-ylsulfonylpyridine (PubChem CID 5268012) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-methoxy-5-piperidin-1-ylsulfonylpyridine.
| Compound Name | 2-methoxy-5-piperidin-1-ylsulfonylpyridine |
|---|---|
| PubChem CID | 5268012 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-methoxy-5-piperidin-1-ylsulfonylpyridine |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC2)cn1 |
| InChI | InChI=1S/C11H16N2O3S/c1-16-11-6-5-10(9-12-11)17(14,15)13-7-3-2-4-8-13/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | PRHVQVNTOAVEQG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |