C11H13F3N2O3S — CID 75448158
5-pyrrolidin-1-ylsulfonyl-2-(2,2,2-trifluoroethoxy)pyridine (PubChem CID 75448158) has the molecular formula C11H13F3N2O3S and a molecular weight of 310.30 g/mol. Its IUPAC name is 5-pyrrolidin-1-ylsulfonyl-2-(2,2,2-trifluoroethoxy)pyridine.
| Compound Name | 5-pyrrolidin-1-ylsulfonyl-2-(2,2,2-trifluoroethoxy)pyridine |
|---|---|
| PubChem CID | 75448158 |
| Molecular Formula | C11H13F3N2O3S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 5-pyrrolidin-1-ylsulfonyl-2-(2,2,2-trifluoroethoxy)pyridine |
| SMILES | O=S(=O)(c1ccc(OCC(F)(F)F)nc1)N1CCCC1 |
| InChI | InChI=1S/C11H13F3N2O3S/c12-11(13,14)8-19-10-4-3-9(7-15-10)20(17,18)16-5-1-2-6-16/h3-4,7H,1-2,5-6,8H2 |
| InChIKey | BTSPREYWVWSNNF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |