C14H19F3N2O3S — CID 3688661
5-(azepan-1-ylsulfonyl)-2-(2,2,2-trifluoroethoxy)aniline (PubChem CID 3688661) has the molecular formula C14H19F3N2O3S and a molecular weight of 352.38 g/mol. Its IUPAC name is 5-(azepan-1-ylsulfonyl)-2-(2,2,2-trifluoroethoxy)aniline.
| Compound Name | 5-(azepan-1-ylsulfonyl)-2-(2,2,2-trifluoroethoxy)aniline |
|---|---|
| PubChem CID | 3688661 |
| Molecular Formula | C14H19F3N2O3S |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 5-(azepan-1-ylsulfonyl)-2-(2,2,2-trifluoroethoxy)aniline |
| SMILES | Nc1cc(S(=O)(=O)N2CCCCCC2)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C14H19F3N2O3S/c15-14(16,17)10-22-13-6-5-11(9-12(13)18)23(20,21)19-7-3-1-2-4-8-19/h5-6,9H,1-4,7-8,10,18H2 |
| InChIKey | RATLPTXFDUAEJY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|