C19H27F3N2O6S — CID 43037505
N-[5-(azepan-1-ylsulfonyl)-2-(2,2,2-trifluoroethoxy)phenyl]-2-(2-methoxyethoxy)acetamide (PubChem CID 43037505) has the molecular formula C19H27F3N2O6S and a molecular weight of 468.49 g/mol. Its IUPAC name is N-[5-(azepan-1-ylsulfonyl)-2-(2,2,2-trifluoroethoxy)phenyl]-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-[5-(azepan-1-ylsulfonyl)-2-(2,2,2-trifluoroethoxy)phenyl]-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 43037505 |
| Molecular Formula | C19H27F3N2O6S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | N-[5-(azepan-1-ylsulfonyl)-2-(2,2,2-trifluoroethoxy)phenyl]-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)Nc1cc(S(=O)(=O)N2CCCCCC2)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C19H27F3N2O6S/c1-28-10-11-29-13-18(25)23-16-12-15(6-7-17(16)30-14-19(20,21)22)31(26,27)24-8-4-2-3-5-9-24/h6-7,12H,2-5,8-11,13-14H2,1H3,(H,23,25) |
| InChIKey | GYBTXIFNVIUQLL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|