C11H13N3O3S — CID 146541445
1-[(6-methoxy-3-pyridinyl)sulfonyl]pyrrolidine-2-carbonitrile (PubChem CID 146541445) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 1-[(6-methoxy-3-pyridinyl)sulfonyl]pyrrolidine-2-carbonitrile.
| Compound Name | 1-[(6-methoxy-3-pyridinyl)sulfonyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 146541445 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 1-[(6-methoxy-3-pyridinyl)sulfonyl]pyrrolidine-2-carbonitrile |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2C#N)cn1 |
| InChI | InChI=1S/C11H13N3O3S/c1-17-11-5-4-10(8-13-11)18(15,16)14-6-2-3-9(14)7-12/h4-5,8-9H,2-3,6H2,1H3 |
| InChIKey | VJEIIQOCLWDAEI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |