C15H16N2O3S — CID 99803410
1-[(6-methoxy-3-pyridinyl)sulfonyl]-3,4-dihydro-2H-quinoline (PubChem CID 99803410) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is 1-[(6-methoxy-3-pyridinyl)sulfonyl]-3,4-dihydro-2H-quinoline.
| Compound Name | 1-[(6-methoxy-3-pyridinyl)sulfonyl]-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 99803410 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-[(6-methoxy-3-pyridinyl)sulfonyl]-3,4-dihydro-2H-quinoline |
| SMILES | COc1ccc(S(=O)(=O)N2CCCc3ccccc32)cn1 |
| InChI | InChI=1S/C15H16N2O3S/c1-20-15-9-8-13(11-16-15)21(18,19)17-10-4-6-12-5-2-3-7-14(12)17/h2-3,5,7-9,11H,4,6,10H2,1H3 |
| InChIKey | QXKWLYQOKWPPKZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |