C13H20N6O3S — CID 139523369
2-[[2-amino-9-(2-hydroxyethyl)-6-oxo-1H-purin-8-yl]sulfanyl]-N-(2-methylpropyl)acetamide (PubChem CID 139523369) has the molecular formula C13H20N6O3S and a molecular weight of 340.41 g/mol. Its IUPAC name is 2-[[2-amino-9-(2-hydroxyethyl)-6-oxo-1H-purin-8-yl]sulfanyl]-N-(2-methylpropyl)acetamide.
| Compound Name | 2-[[2-amino-9-(2-hydroxyethyl)-6-oxo-1H-purin-8-yl]sulfanyl]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 139523369 |
| Molecular Formula | C13H20N6O3S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 2-[[2-amino-9-(2-hydroxyethyl)-6-oxo-1H-purin-8-yl]sulfanyl]-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CNC(=O)CSc1nc2c(=O)[nH]c(N)nc2n1CCO |
| InChI | InChI=1S/C13H20N6O3S/c1-7(2)5-15-8(21)6-23-13-16-9-10(19(13)3-4-20)17-12(14)18-11(9)22/h7,20H,3-6H2,1-2H3,(H,15,21)(H3,14,17,18,22) |
| InChIKey | KVDMACSSZOVCPW-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 138.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |