C25H23N6O2P — CID 166788856
2-amino-9-(2-hydroxyethyl)-8-[(triphenyl-λ5-phosphanylidene)amino]-1H-purin-6-one (PubChem CID 166788856) has the molecular formula C25H23N6O2P and a molecular weight of 470.47 g/mol. Its IUPAC name is 2-amino-9-(2-hydroxyethyl)-8-[(triphenyl-λ5-phosphanylidene)amino]-1H-purin-6-one.
| Compound Name | 2-amino-9-(2-hydroxyethyl)-8-[(triphenyl-λ5-phosphanylidene)amino]-1H-purin-6-one |
|---|---|
| PubChem CID | 166788856 |
| Molecular Formula | C25H23N6O2P |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 2-amino-9-(2-hydroxyethyl)-8-[(triphenyl-λ5-phosphanylidene)amino]-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(N=P(c3ccccc3)(c3ccccc3)c3ccccc3)n2CCO)c(=O)[nH]1 |
| InChI | InChI=1S/C25H23N6O2P/c26-24-28-22-21(23(33)29-24)27-25(31(22)16-17-32)30-34(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,32H,16-17H2,(H3,26,28,29,33) |
| InChIKey | AVEWTJSDFXSMKQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 122.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|