C13H12FN5OS — CID 155290817
2-amino-9-[(4-fluorophenyl)methyl]-8-methylsulfanyl-1H-purin-6-one (PubChem CID 155290817) has the molecular formula C13H12FN5OS and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-amino-9-[(4-fluorophenyl)methyl]-8-methylsulfanyl-1H-purin-6-one.
| Compound Name | 2-amino-9-[(4-fluorophenyl)methyl]-8-methylsulfanyl-1H-purin-6-one |
|---|---|
| PubChem CID | 155290817 |
| Molecular Formula | C13H12FN5OS |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2-amino-9-[(4-fluorophenyl)methyl]-8-methylsulfanyl-1H-purin-6-one |
| SMILES | CSc1nc2c(=O)[nH]c(N)nc2n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H12FN5OS/c1-21-13-16-9-10(17-12(15)18-11(9)20)19(13)6-7-2-4-8(14)5-3-7/h2-5H,6H2,1H3,(H3,15,17,18,20) |
| InChIKey | YQWAXDPFOSTNGP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |